C19H19N5O3S2 — CID 75118812
2-oxo-N-[4-[3-oxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide (PubChem CID 75118812) has the molecular formula C19H19N5O3S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-oxo-N-[4-[3-oxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide.
| Compound Name | 2-oxo-N-[4-[3-oxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75118812 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-oxo-N-[4-[3-oxo-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)propyl]-1,3-thiazol-2-yl]-3H-pyridine-3-carboxamide |
| SMILES | O=C(CCc1csc(NC(=O)C2C=CC=NC2=O)n1)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H19N5O3S2/c25-15(23-19-22-13-5-1-2-6-14(13)29-19)8-7-11-10-28-18(21-11)24-17(27)12-4-3-9-20-16(12)26/h3-4,9-10,12H,1-2,5-8H2,(H,21,24,27)(H,22,23,25) |
| InChIKey | LBFNFCKLWSEXGL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|