C22H28N3O3S+ — CID 7511992
2-[benzoyl-(4,7-dimethoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium (PubChem CID 7511992) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[benzoyl-(4,7-dimethoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium.
| Compound Name | 2-[benzoyl-(4,7-dimethoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7511992 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[benzoyl-(4,7-dimethoxy-1,3-benzothiazol-2-yl)amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN(C(=O)c1ccccc1)c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C22H27N3O3S/c1-5-24(6-2)14-15-25(21(26)16-10-8-7-9-11-16)22-23-19-17(27-3)12-13-18(28-4)20(19)29-22/h7-13H,5-6,14-15H2,1-4H3/p+1 |
| InChIKey | UXBRBBUBUSEHNU-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |