C10H4Cl8 — CID 75124212
(1S,2S,5R,6S)-1,4,5,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 75124212) has the molecular formula C10H4Cl8 and a molecular weight of 407.77 g/mol. Its IUPAC name is (1S,2S,5R,6S)-1,4,5,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1S,2S,5R,6S)-1,4,5,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 75124212 |
| Molecular Formula | C10H4Cl8 |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 403.78 |
| IUPAC Name | (1S,2S,5R,6S)-1,4,5,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | ClC1=C[C@H]2[C@@H]([C@H]1Cl)C1(Cl)C(Cl)=C(Cl)[C@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C10H4Cl8/c11-3-1-2-4(5(3)12)9(16)7(14)6(13)8(2,15)10(9,17)18/h1-2,4-5H/t2-,4-,5-,8-,9?/m0/s1 |
| InChIKey | MXWWQTOZVNNERA-FPLZKDNJSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|