C9H11NO2 — CID 75132316
2-(furan-3-yl)piperidin-4-one (PubChem CID 75132316) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-(furan-3-yl)piperidin-4-one.
| Compound Name | 2-(furan-3-yl)piperidin-4-one |
|---|---|
| PubChem CID | 75132316 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-(furan-3-yl)piperidin-4-one |
| SMILES | O=C1CCNC(c2ccoc2)C1 |
| InChI | InChI=1S/C9H11NO2/c11-8-1-3-10-9(5-8)7-2-4-12-6-7/h2,4,6,9-10H,1,3,5H2 |
| InChIKey | NTCKMMDMZFPSKK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |