C12H13N3O3 — CID 75134522
2-(2,4-dioxo-4aH-quinazolin-3-yl)-N-ethylacetamide (PubChem CID 75134522) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(2,4-dioxo-4aH-quinazolin-3-yl)-N-ethylacetamide.
| Compound Name | 2-(2,4-dioxo-4aH-quinazolin-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 75134522 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(2,4-dioxo-4aH-quinazolin-3-yl)-N-ethylacetamide |
| SMILES | CCNC(=O)CN1C(=O)N=C2C=CC=CC2C1=O |
| InChI | InChI=1S/C12H13N3O3/c1-2-13-10(16)7-15-11(17)8-5-3-4-6-9(8)14-12(15)18/h3-6,8H,2,7H2,1H3,(H,13,16) |
| InChIKey | ULFCQHWFYFHEBV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |