About [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate (PubChem CID 7514502) has the molecular formula C17H26N2O4
and a molecular weight of 322.41 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate.
Molecular Properties
| Compound Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate |
| PubChem CID | 7514502 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate |
| SMILES | CC(C)[C@@H](OC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NC(N)=O |
| InChI | InChI=1S/C17H26N2O4/c1-9(2)13(14(20)19-16(18)22)23-15(21)17-6-10-3-11(7-17)5-12(4-10)8-17/h9-13H,3-8H2,1-2H3,(H3,18,19,20,22)/t10?,11?,12?,13-,17?/m1/s1 |
| InChIKey | RXPVNTBQVOSUDZ-CQCMJFKXSA-N |
| XLogP | 1.97 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate?
The IUPAC name of [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate (CID 7514502) is [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate.
What is the SMILES notation for [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate?
The canonical SMILES for [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate is CC(C)[C@@H](OC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NC(N)=O.
What is the InChIKey of [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate?
The InChIKey is RXPVNTBQVOSUDZ-CQCMJFKXSA-N. The full InChI is InChI=1S/C17H26N2O4/c1-9(2)13(14(20)19-16(18)22)23-15(21)17-6-10-3-11(7-17)5-12(4-10)8-17/h9-13H,3-8H2,1-2H3,(H3,18,19,20,22)/t10?,11?,12?,13-,17?/m1/s1.
What are the key properties of [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate?
[(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate has a molecular weight of 322.41 g/mol, XLogP of 1.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] adamantane-1-carboxylate is sourced from PubChem (CID 7514502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).