C32H31N3OS — CID 75145150
3-(3-dibenzothiophen-4-ylphenyl)-N-(3,7-dimethylocta-2,6-dienyl)imidazole-4-carboxamide (PubChem CID 75145150) has the molecular formula C32H31N3OS and a molecular weight of 505.69 g/mol. Its IUPAC name is 3-(3-dibenzothiophen-4-ylphenyl)-N-(3,7-dimethylocta-2,6-dienyl)imidazole-4-carboxamide.
| Compound Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-(3,7-dimethylocta-2,6-dienyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 75145150 |
| Molecular Formula | C32H31N3OS |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 3-(3-dibenzothiophen-4-ylphenyl)-N-(3,7-dimethylocta-2,6-dienyl)imidazole-4-carboxamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)c1cncn1-c1cccc(-c2cccc3c2sc2ccccc23)c1 |
| InChI | InChI=1S/C32H31N3OS/c1-22(2)9-6-10-23(3)17-18-34-32(36)29-20-33-21-35(29)25-12-7-11-24(19-25)26-14-8-15-28-27-13-4-5-16-30(27)37-31(26)28/h4-5,7-9,11-17,19-21H,6,10,18H2,1-3H3,(H,34,36) |
| InChIKey | FIRHMBLFKALFDB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|