C24H22FN5O3 — CID 75146007
4-(4-fluorophenyl)-9-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazine (PubChem CID 75146007) has the molecular formula C24H22FN5O3 and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-9-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazine.
| Compound Name | 4-(4-fluorophenyl)-9-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazine |
|---|---|
| PubChem CID | 75146007 |
| Molecular Formula | C24H22FN5O3 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-(4-fluorophenyl)-9-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazine |
| SMILES | Cc1cn(-c2ccc(C=C3OCCN4C3=NCCN4c3ccc(F)cc3)c3c2OCO3)cn1 |
| InChI | InChI=1S/C24H22FN5O3/c1-16-13-28(14-27-16)20-7-2-17(22-23(20)33-15-32-22)12-21-24-26-8-9-29(30(24)10-11-31-21)19-5-3-18(25)4-6-19/h2-7,12-14H,8-11,15H2,1H3 |
| InChIKey | KPQVUSOTDFHAEJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |