C9H14N2O2 — CID 75146557
5-propyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 75146557) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-propyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-propyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 75146557 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5-propyl-2,3,3a,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCN1C(=O)C2CNCC2C1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-11-8(12)6-4-10-5-7(6)9(11)13/h6-7,10H,2-5H2,1H3 |
| InChIKey | QNMANEXBKGGCGE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|