C12H24N2 — CID 75147107
N'-(3,7-dimethylocta-2,6-dienyl)ethane-1,2-diamine (PubChem CID 75147107) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N'-(3,7-dimethylocta-2,6-dienyl)ethane-1,2-diamine.
| Compound Name | N'-(3,7-dimethylocta-2,6-dienyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 75147107 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N'-(3,7-dimethylocta-2,6-dienyl)ethane-1,2-diamine |
| SMILES | CC(C)=CCCC(C)=CCNCCN |
| InChI | InChI=1S/C12H24N2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7,14H,4,6,8-10,13H2,1-3H3 |
| InChIKey | JCIITWXLJRJGNM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|