C16H19N5O2 — CID 75147947
ethyl 2-azido-3-(2-tert-butylimidazo[1,2-a]pyridin-8-yl)prop-2-enoate (PubChem CID 75147947) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 2-azido-3-(2-tert-butylimidazo[1,2-a]pyridin-8-yl)prop-2-enoate.
| Compound Name | ethyl 2-azido-3-(2-tert-butylimidazo[1,2-a]pyridin-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 75147947 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 2-azido-3-(2-tert-butylimidazo[1,2-a]pyridin-8-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1cccn2cc(C(C)(C)C)nc12)N=[N+]=[N-] |
| InChI | InChI=1S/C16H19N5O2/c1-5-23-15(22)12(19-20-17)9-11-7-6-8-21-10-13(16(2,3)4)18-14(11)21/h6-10H,5H2,1-4H3 |
| InChIKey | QJJYOWJBDOOZSX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|