About (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone (PubChem CID 751492) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone |
| PubChem CID | 751492 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1ccco1)CC2 |
| InChI | InChI=1S/C16H17NO4/c1-19-14-8-11-5-6-17(10-12(11)9-15(14)20-2)16(18)13-4-3-7-21-13/h3-4,7-9H,5-6,10H2,1-2H3 |
| InChIKey | CECGSVVPTWTPAP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone?
The IUPAC name of (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone (CID 751492) is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone.
What is the SMILES notation for (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone?
The canonical SMILES for (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone is COc1cc2c(cc1OC)CN(C(=O)c1ccco1)CC2.
What is the InChIKey of (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone?
The InChIKey is CECGSVVPTWTPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c1-19-14-8-11-5-6-17(10-12(11)9-15(14)20-2)16(18)13-4-3-7-21-13/h3-4,7-9H,5-6,10H2,1-2H3.
What are the key properties of (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone?
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone has a molecular weight of 287.32 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(furan-2-yl)methanone is sourced from PubChem (CID 751492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).