C41H70O14 — CID 75149467
2-(hydroxymethyl)-6-[[7,7,12,16-tetramethyl-15-(3,5,6-trihydroxy-6-methylheptan-2-yl)-6-(3,4,5-trihydroxyoxan-2-yl)oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol (PubChem CID 75149467) has the molecular formula C41H70O14 and a molecular weight of 787.00 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[7,7,12,16-tetramethyl-15-(3,5,6-trihydroxy-6-methylheptan-2-yl)-6-(3,4,5-trihydroxyoxan-2-yl)oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[[7,7,12,16-tetramethyl-15-(3,5,6-trihydroxy-6-methylheptan-2-yl)-6-(3,4,5-trihydroxyoxan-2-yl)oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 75149467 |
| Molecular Formula | C41H70O14 |
| Molecular Weight | 787.00 g/mol |
| Exact Mass | 786.48 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[7,7,12,16-tetramethyl-15-(3,5,6-trihydroxy-6-methylheptan-2-yl)-6-(3,4,5-trihydroxyoxan-2-yl)oxy-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]oxane-3,4,5-triol |
| SMILES | CC(C(O)CC(O)C(C)(C)O)C1C(OC2OC(CO)C(O)C(O)C2O)CC2(C)C3CCC4C(C)(C)C(OC5OCC(O)C(O)C5O)CCC45CC35CCC12C |
| InChI | InChI=1S/C41H70O14/c1-19(20(43)14-26(45)37(4,5)51)28-22(53-35-33(50)31(48)30(47)23(16-42)54-35)15-39(7)25-9-8-24-36(2,3)27(55-34-32(49)29(46)21(44)17-52-34)10-11-40(24)18-41(25,40)13-12-38(28,39)6/h19-35,42-51H,8-18H2,1-7H3 |
| InChIKey | NBEGGPDIBIJZHI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 239.22 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.00 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|