C18H22FN7O — CID 75150958
6-[6-(3-ethylmorpholin-4-yl)-2-(methylamino)pyrimidin-4-yl]-4-fluoro-1H-indazol-3-amine (PubChem CID 75150958) has the molecular formula C18H22FN7O and a molecular weight of 371.42 g/mol. Its IUPAC name is 6-[6-(3-ethylmorpholin-4-yl)-2-(methylamino)pyrimidin-4-yl]-4-fluoro-1H-indazol-3-amine.
| Compound Name | 6-[6-(3-ethylmorpholin-4-yl)-2-(methylamino)pyrimidin-4-yl]-4-fluoro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 75150958 |
| Molecular Formula | C18H22FN7O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 6-[6-(3-ethylmorpholin-4-yl)-2-(methylamino)pyrimidin-4-yl]-4-fluoro-1H-indazol-3-amine |
| SMILES | CCC1COCCN1c1cc(-c2cc(F)c3c(N)n[nH]c3c2)nc(NC)n1 |
| InChI | InChI=1S/C18H22FN7O/c1-3-11-9-27-5-4-26(11)15-8-13(22-18(21-2)23-15)10-6-12(19)16-14(7-10)24-25-17(16)20/h6-8,11H,3-5,9H2,1-2H3,(H3,20,24,25)(H,21,22,23) |
| InChIKey | OFBODNKGVQAIPC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |