C20H20F4N2O2 — CID 75151271
N-[1-(3-fluorophenyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 75151271) has the molecular formula C20H20F4N2O2 and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75151271 |
| Molecular Formula | C20H20F4N2O2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-4-[4-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CNCC1c1ccc(OC(F)(F)F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H20F4N2O2/c1-12(14-3-2-4-15(21)9-14)26-19(27)18-11-25-10-17(18)13-5-7-16(8-6-13)28-20(22,23)24/h2-9,12,17-18,25H,10-11H2,1H3,(H,26,27) |
| InChIKey | NLQKNNMTAHCNFX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |