C15H22O6 — CID 75154102
6,8-dihydroxy-3,6,8-trimethylspiro[3a,4,5,8a-tetrahydro-3H-cyclohepta[b]furan-7,5'-oxolane]-2,2'-dione (PubChem CID 75154102) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 6,8-dihydroxy-3,6,8-trimethylspiro[3a,4,5,8a-tetrahydro-3H-cyclohepta[b]furan-7,5'-oxolane]-2,2'-dione.
| Compound Name | 6,8-dihydroxy-3,6,8-trimethylspiro[3a,4,5,8a-tetrahydro-3H-cyclohepta[b]furan-7,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 75154102 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6,8-dihydroxy-3,6,8-trimethylspiro[3a,4,5,8a-tetrahydro-3H-cyclohepta[b]furan-7,5'-oxolane]-2,2'-dione |
| SMILES | CC1C(=O)OC2C1CCC(C)(O)C1(CCC(=O)O1)C2(C)O |
| InChI | InChI=1S/C15H22O6/c1-8-9-4-6-13(2,18)15(7-5-10(16)21-15)14(3,19)11(9)20-12(8)17/h8-9,11,18-19H,4-7H2,1-3H3 |
| InChIKey | OOVPUQLRCZYQEA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |