C18H18N4O3 — CID 75158870
N-(3-nitrophenyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide (PubChem CID 75158870) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide.
| Compound Name | N-(3-nitrophenyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 75158870 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(3-nitrophenyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]indazole-3-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C1NNC2c3ccccc3CCC12 |
| InChI | InChI=1S/C18H18N4O3/c23-18(19-12-5-3-6-13(10-12)22(24)25)17-15-9-8-11-4-1-2-7-14(11)16(15)20-21-17/h1-7,10,15-17,20-21H,8-9H2,(H,19,23) |
| InChIKey | ZXGULBKNMCTFOA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|