C15H14N4O3 — CID 75158933
2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-5-yl]acetonitrile (PubChem CID 75158933) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-5-yl]acetonitrile.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-5-yl]acetonitrile |
|---|---|
| PubChem CID | 75158933 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,2,3,3a-tetrahydropyrazolo[1,5-a]pyrazin-5-yl]acetonitrile |
| SMILES | N#CCN1C=CN2NC(c3ccc4c(c3)OCO4)CC2C1=O |
| InChI | InChI=1S/C15H14N4O3/c16-3-4-18-5-6-19-12(15(18)20)8-11(17-19)10-1-2-13-14(7-10)22-9-21-13/h1-2,5-7,11-12,17H,4,8-9H2 |
| InChIKey | UEZFMUJCKUAJTF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|