C25H33N2O6+ — CID 75162816
(6-carboxy-3,4,5-trihydroxyoxan-2-yl)-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-dimethylazanium (PubChem CID 75162816) has the molecular formula C25H33N2O6+ and a molecular weight of 457.55 g/mol. Its IUPAC name is (6-carboxy-3,4,5-trihydroxyoxan-2-yl)-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-dimethylazanium.
| Compound Name | (6-carboxy-3,4,5-trihydroxyoxan-2-yl)-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 75162816 |
| Molecular Formula | C25H33N2O6+ |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (6-carboxy-3,4,5-trihydroxyoxan-2-yl)-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN1c2ccccc2CCc2ccccc21)C1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C25H32N2O6/c1-27(2,24-22(30)20(28)21(29)23(33-24)25(31)32)15-7-14-26-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)26/h3-6,8-11,20-24,28-30H,7,12-15H2,1-2H3/p+1 |
| InChIKey | CXPKQHSXFUNBMP-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|