C16H15F2NO4S2 — CID 7516358
3-[4-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoic acid (PubChem CID 7516358) has the molecular formula C16H15F2NO4S2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-[4-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 7516358 |
| Molecular Formula | C16H15F2NO4S2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 3-[4-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(S(=O)(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F2NO4S2/c17-16(18)24-13-6-4-12(5-7-13)19-25(22,23)14-8-1-11(2-9-14)3-10-15(20)21/h1-2,4-9,16,19H,3,10H2,(H,20,21) |
| InChIKey | JSDOPJRBJIFSIX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |