C15H22O2 — CID 75163729
5-(2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpenta-2,4-dienoic acid (PubChem CID 75163729) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-(2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-(2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 75163729 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 5-(2,2-dimethyl-6-methylidenecyclohexyl)-3-methylpenta-2,4-dienoic acid |
| SMILES | C=C1CCCC(C)(C)C1C=CC(C)=CC(=O)O |
| InChI | InChI=1S/C15H22O2/c1-11(10-14(16)17)7-8-13-12(2)6-5-9-15(13,3)4/h7-8,10,13H,2,5-6,9H2,1,3-4H3,(H,16,17) |
| InChIKey | NPLQKYGNQZPTFE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|