C16H15FNO4S- — CID 7516478
3-[4-[(5-fluoro-2-methylphenyl)sulfamoyl]phenyl]propanoate (PubChem CID 7516478) has the molecular formula C16H15FNO4S- and a molecular weight of 336.36 g/mol. Its IUPAC name is 3-[4-[(5-fluoro-2-methylphenyl)sulfamoyl]phenyl]propanoate.
| Compound Name | 3-[4-[(5-fluoro-2-methylphenyl)sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 7516478 |
| Molecular Formula | C16H15FNO4S- |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-[4-[(5-fluoro-2-methylphenyl)sulfamoyl]phenyl]propanoate |
| SMILES | Cc1ccc(F)cc1NS(=O)(=O)c1ccc(CCC(=O)[O-])cc1 |
| InChI | InChI=1S/C16H16FNO4S/c1-11-2-6-13(17)10-15(11)18-23(21,22)14-7-3-12(4-8-14)5-9-16(19)20/h2-4,6-8,10,18H,5,9H2,1H3,(H,19,20)/p-1 |
| InChIKey | PNCPWNKRCHPNIW-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |