About 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate
3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate (PubChem CID 7516485) has the molecular formula C15H11F3NO4S-
and a molecular weight of 358.32 g/mol. Its IUPAC name is 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate.
Molecular Properties
| Compound Name | 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate |
| PubChem CID | 7516485 |
| Molecular Formula | C15H11F3NO4S- |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate |
| SMILES | O=C([O-])CCc1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H12F3NO4S/c16-11-6-7-12(15(18)14(11)17)19-24(22,23)10-4-1-9(2-5-10)3-8-13(20)21/h1-2,4-7,19H,3,8H2,(H,20,21)/p-1 |
| InChIKey | UDCNIQRLIRBKIY-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate?
The IUPAC name of 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate (CID 7516485) is 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate.
What is the SMILES notation for 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate?
The canonical SMILES for 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate is O=C([O-])CCc1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)cc1.
What is the InChIKey of 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate?
The InChIKey is UDCNIQRLIRBKIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H12F3NO4S/c16-11-6-7-12(15(18)14(11)17)19-24(22,23)10-4-1-9(2-5-10)3-8-13(20)21/h1-2,4-7,19H,3,8H2,(H,20,21)/p-1.
What are the key properties of 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate?
3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate has a molecular weight of 358.32 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,3,4-trifluorophenyl)sulfamoyl]phenyl]propanoate is sourced from PubChem (CID 7516485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).