C29H36O12 — CID 75166540
11,22,23-trihydroxy-9,9,18,23,25-pentamethyl-4,8,16,20,28-pentaoxaoctacyclo[13.12.1.115,22.01,13.03,7.03,10.017,21.025,29]nonacosane-5,14,19,24-tetrone (PubChem CID 75166540) has the molecular formula C29H36O12 and a molecular weight of 576.60 g/mol. Its IUPAC name is 11,22,23-trihydroxy-9,9,18,23,25-pentamethyl-4,8,16,20,28-pentaoxaoctacyclo[13.12.1.115,22.01,13.03,7.03,10.017,21.025,29]nonacosane-5,14,19,24-tetrone.
| Compound Name | 11,22,23-trihydroxy-9,9,18,23,25-pentamethyl-4,8,16,20,28-pentaoxaoctacyclo[13.12.1.115,22.01,13.03,7.03,10.017,21.025,29]nonacosane-5,14,19,24-tetrone |
|---|---|
| PubChem CID | 75166540 |
| Molecular Formula | C29H36O12 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 11,22,23-trihydroxy-9,9,18,23,25-pentamethyl-4,8,16,20,28-pentaoxaoctacyclo[13.12.1.115,22.01,13.03,7.03,10.017,21.025,29]nonacosane-5,14,19,24-tetrone |
| SMILES | CC1C(=O)OC2C1OC13OC4(CCC5(C)C(=O)C(C)(O)C2(O)C51)CC12OC(=O)CC1OC(C)(C)C2C(O)CC4C3=O |
| InChI | InChI=1S/C29H36O12/c1-11-16-19(37-20(11)33)28(36)21-24(4,22(34)25(28,5)35)6-7-26-10-27-14(9-15(31)39-27)38-23(2,3)17(27)13(30)8-12(26)18(32)29(21,40-16)41-26/h11-14,16-17,19,21,30,35-36H,6-10H2,1-5H3 |
| InChIKey | LWXUKQORMRLSCU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |