C13H7F5N2OS — CID 7516719
N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 7516719) has the molecular formula C13H7F5N2OS and a molecular weight of 334.27 g/mol. Its IUPAC name is N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 7516719 |
| Molecular Formula | C13H7F5N2OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)N/N=C\c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H7F5N2OS/c14-9-7(10(15)12(17)13(18)11(9)16)5-19-20-8(21)4-6-2-1-3-22-6/h1-3,5H,4H2,(H,20,21)/b19-5- |
| InChIKey | IQSXHAOFXKRFIK-IPKBDRFQSA-N |
| XLogP | 3.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|