About (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium
(6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium (PubChem CID 75167447) has the molecular formula C20H32NO2+
and a molecular weight of 318.48 g/mol. Its IUPAC name is (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium.
Molecular Properties
| Compound Name | (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium |
| PubChem CID | 75167447 |
| Molecular Formula | C20H32NO2+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium |
| SMILES | C[N+](C)(C)CC1COCC(c2ccccc2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C20H32NO2/c1-21(2,3)14-19-15-22-16-20(23-19,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-7,10-11,18-19H,5,8-9,12-16H2,1-3H3/q+1 |
| InChIKey | UFSZYKLBZJNXLV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium?
The IUPAC name of (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium (CID 75167447) is (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium.
What is the SMILES notation for (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium?
The canonical SMILES for (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium is C[N+](C)(C)CC1COCC(c2ccccc2)(C2CCCCC2)O1.
What is the InChIKey of (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium?
The InChIKey is UFSZYKLBZJNXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32NO2/c1-21(2,3)14-19-15-22-16-20(23-19,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4,6-7,10-11,18-19H,5,8-9,12-16H2,1-3H3/q+1.
What are the key properties of (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium?
(6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium has a molecular weight of 318.48 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyclohexyl-6-phenyl-1,4-dioxan-2-yl)methyl-trimethylazanium is sourced from PubChem (CID 75167447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).