C14H21N3S — CID 751717
1-(2,4-dimethylphenyl)-5-propyl-1,3,5-triazinane-2-thione (PubChem CID 751717) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-5-propyl-1,3,5-triazinane-2-thione.
| Compound Name | 1-(2,4-dimethylphenyl)-5-propyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 751717 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-5-propyl-1,3,5-triazinane-2-thione |
| SMILES | CCCN1CNC(=S)N(c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C14H21N3S/c1-4-7-16-9-15-14(18)17(10-16)13-6-5-11(2)8-12(13)3/h5-6,8H,4,7,9-10H2,1-3H3,(H,15,18) |
| InChIKey | BPACRRXGBCUIOY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|