About (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride
(2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride (PubChem CID 75176180) has the molecular formula C9H11BrClN
and a molecular weight of 248.55 g/mol. Its IUPAC name is (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| PubChem CID | 75176180 |
| Molecular Formula | C9H11BrClN |
| Molecular Weight | 248.55 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| SMILES | Cl.N[C@H]1Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C9H10BrN.ClH/c10-8-2-1-6-4-9(11)5-7(6)3-8;/h1-3,9H,4-5,11H2;1H/t9-;/m0./s1 |
| InChIKey | ZYIZCCGZFWRSTN-FVGYRXGTSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The IUPAC name of (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride (CID 75176180) is (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride.
What is the SMILES notation for (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The canonical SMILES for (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride is Cl.N[C@H]1Cc2ccc(Br)cc2C1.
What is the InChIKey of (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride?
The InChIKey is ZYIZCCGZFWRSTN-FVGYRXGTSA-N. The full InChI is InChI=1S/C9H10BrN.ClH/c10-8-2-1-6-4-9(11)5-7(6)3-8;/h1-3,9H,4-5,11H2;1H/t9-;/m0./s1.
What are the key properties of (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride?
(2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride has a molecular weight of 248.55 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-bromo-2,3-dihydro-1H-inden-2-amine;hydrochloride is sourced from PubChem (CID 75176180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).