C8H4BrClF3N3 — CID 75176233
3-(bromomethyl)-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 75176233) has the molecular formula C8H4BrClF3N3 and a molecular weight of 314.49 g/mol. Its IUPAC name is 3-(bromomethyl)-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(bromomethyl)-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 75176233 |
| Molecular Formula | C8H4BrClF3N3 |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | 3-(bromomethyl)-8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | FC(F)(F)c1cc(Cl)c2nnc(CBr)n2c1 |
| InChI | InChI=1S/C8H4BrClF3N3/c9-2-6-14-15-7-5(10)1-4(3-16(6)7)8(11,12)13/h1,3H,2H2 |
| InChIKey | ZYJONKJSIZOVCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|