3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid

C11H10N2O4 — CID 751782

IUPAC3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid
SMILESCCn1c(=O)[nH]c2cc(C(=O)O)ccc2c1=O
InChIInChI=1S/C11H10N2O4/c1-2-13-9(14)7-4-3-6(10(15)16)5-8(7)12-11(13)17/h3-5H,2H2,1H3,(H,12,17)(H,15,16)
InChIKeyOHJOFBNVZGMMRO-UHFFFAOYSA-N
MW234.21 g/mol
LogP0.41
Rot. Bonds2

About 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid

3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid (PubChem CID 751782) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid
PubChem CID751782
Molecular FormulaC11H10N2O4
Molecular Weight234.21 g/mol
Exact Mass234.06
IUPAC Name3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid
SMILESCCn1c(=O)[nH]c2cc(C(=O)O)ccc2c1=O
InChIInChI=1S/C11H10N2O4/c1-2-13-9(14)7-4-3-6(10(15)16)5-8(7)12-11(13)17/h3-5H,2H2,1H3,(H,12,17)(H,15,16)
InChIKeyOHJOFBNVZGMMRO-UHFFFAOYSA-N
XLogP0.41
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.21
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid?
The IUPAC name of 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid (CID 751782) is 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid.
What is the SMILES notation for 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid?
The canonical SMILES for 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid is CCn1c(=O)[nH]c2cc(C(=O)O)ccc2c1=O.
What is the InChIKey of 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid?
The InChIKey is OHJOFBNVZGMMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4/c1-2-13-9(14)7-4-3-6(10(15)16)5-8(7)12-11(13)17/h3-5H,2H2,1H3,(H,12,17)(H,15,16).
What are the key properties of 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid?
3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid has a molecular weight of 234.21 g/mol, XLogP of 0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxylic acid is sourced from PubChem (CID 751782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).