C17H16ClN3O5S — CID 7517828
5-chloro-N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-2-nitrobenzamide (PubChem CID 7517828) has the molecular formula C17H16ClN3O5S and a molecular weight of 409.85 g/mol. Its IUPAC name is 5-chloro-N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 7517828 |
| Molecular Formula | C17H16ClN3O5S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-chloro-N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)-2-nitrobenzamide |
| SMILES | CS(=O)(=O)N1CCCc2ccc(NC(=O)c3cc(Cl)ccc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H16ClN3O5S/c1-27(25,26)20-8-2-3-11-4-6-13(10-16(11)20)19-17(22)14-9-12(18)5-7-15(14)21(23)24/h4-7,9-10H,2-3,8H2,1H3,(H,19,22) |
| InChIKey | NRDJBDTWQDYDNE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|