C20H18ClN3O3S — CID 7518009
N-[2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-methyl-3-nitrobenzamide (PubChem CID 7518009) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is N-[2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 7518009 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1CCNC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H18ClN3O3S/c1-12-16(4-3-5-17(12)24(26)27)19(25)22-11-10-18-13(2)23-20(28-18)14-6-8-15(21)9-7-14/h3-9H,10-11H2,1-2H3,(H,22,25) |
| InChIKey | YYDHIFDQLNJHPX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|