C18H22N2O3S — CID 75180724
5-[[4-[2-(cyclohexylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75180724) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 5-[[4-[2-(cyclohexylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(cyclohexylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75180724 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 5-[[4-[2-(cyclohexylamino)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCCNC3CCCCC3)cc2)S1 |
| InChI | InChI=1S/C18H22N2O3S/c21-17-16(24-18(22)20-17)12-13-6-8-15(9-7-13)23-11-10-19-14-4-2-1-3-5-14/h6-9,12,14,19H,1-5,10-11H2,(H,20,21,22) |
| InChIKey | QJGMTHLUFPOPPA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|