C13H15Cl2N — CID 75181358
3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 75181358) has the molecular formula C13H15Cl2N and a molecular weight of 256.18 g/mol. Its IUPAC name is 3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 75181358 |
| Molecular Formula | C13H15Cl2N |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3a-(3,4-dichlorophenyl)-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Clc1ccc(C23CCCC2CNC3)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N/c14-11-4-3-9(6-12(11)15)13-5-1-2-10(13)7-16-8-13/h3-4,6,10,16H,1-2,5,7-8H2 |
| InChIKey | ZOSQXAHBYHMVCA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |