C28H24FN7OS — CID 75182694
4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-pyridin-2-ylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 75182694) has the molecular formula C28H24FN7OS and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-pyridin-2-ylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-pyridin-2-ylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 75182694 |
| Molecular Formula | C28H24FN7OS |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-pyridin-2-ylsulfanyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4cccc(F)n4)cc3)c2Sc2ccccn2)N2C1=NC1CCCC12 |
| InChI | InChI=1S/C28H24FN7OS/c1-34-26(37)24-25(36-21-8-4-7-20(21)32-28(34)36)33-35(27(24)38-23-10-2-3-15-30-23)16-17-11-13-18(14-12-17)19-6-5-9-22(29)31-19/h2-3,5-6,9-15,20-21H,4,7-8,16H2,1H3 |
| InChIKey | JCKMKEGCPWQQNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 79.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|