C23H30N6O2S — CID 75182888
N-[1-[2-[(1,5-dimethylpyrazol-3-yl)amino]-1,3-oxazol-5-yl]piperidin-3-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 75182888) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[1-[2-[(1,5-dimethylpyrazol-3-yl)amino]-1,3-oxazol-5-yl]piperidin-3-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[(1,5-dimethylpyrazol-3-yl)amino]-1,3-oxazol-5-yl]piperidin-3-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 75182888 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[1-[2-[(1,5-dimethylpyrazol-3-yl)amino]-1,3-oxazol-5-yl]piperidin-3-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | Cc1cc(Nc2ncc(N3CCCC(NC(=O)c4cc5c(s4)CCCCC5)C3)o2)nn1C |
| InChI | InChI=1S/C23H30N6O2S/c1-15-11-20(27-28(15)2)26-23-24-13-21(31-23)29-10-6-8-17(14-29)25-22(30)19-12-16-7-4-3-5-9-18(16)32-19/h11-13,17H,3-10,14H2,1-2H3,(H,25,30)(H,24,26,27) |
| InChIKey | LNFDPQNLPSMKPK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |