C30H29ClN6O6 — CID 75183196
N-[2-[1-(chloromethyl)-5-hydroxy-9-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-[2-(2-hydroxyethoxy)ethyl]triazole-4-carboxamide (PubChem CID 75183196) has the molecular formula C30H29ClN6O6 and a molecular weight of 605.05 g/mol. Its IUPAC name is N-[2-[1-(chloromethyl)-5-hydroxy-9-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-[2-(2-hydroxyethoxy)ethyl]triazole-4-carboxamide.
| Compound Name | N-[2-[1-(chloromethyl)-5-hydroxy-9-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-[2-(2-hydroxyethoxy)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 75183196 |
| Molecular Formula | C30H29ClN6O6 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | N-[2-[1-(chloromethyl)-5-hydroxy-9-methoxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]-1-[2-(2-hydroxyethoxy)ethyl]triazole-4-carboxamide |
| SMILES | COc1cccc2c(O)cc3c(c12)C(CCl)CN3C(=O)c1cc2cc(NC(=O)c3cn(CCOCCO)nn3)ccc2[nH]1 |
| InChI | InChI=1S/C30H29ClN6O6/c1-42-26-4-2-3-20-25(39)13-24-27(28(20)26)18(14-31)15-37(24)30(41)22-12-17-11-19(5-6-21(17)33-22)32-29(40)23-16-36(35-34-23)7-9-43-10-8-38/h2-6,11-13,16,18,33,38-39H,7-10,14-15H2,1H3,(H,32,40) |
| InChIKey | OOPSEKDXUZWSLC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 154.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|