C16H14F9NO4 — CID 75184493
methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 75184493) has the molecular formula C16H14F9NO4 and a molecular weight of 455.27 g/mol. Its IUPAC name is methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 75184493 |
| Molecular Formula | C16H14F9NO4 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoro-2-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)C(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H14F9NO4/c1-29-11(27)10(26-12(28)30-8-9-5-3-2-4-6-9)7-13(17,18)14(19,20)15(21,22)16(23,24)25/h2-6,10H,7-8H2,1H3,(H,26,28) |
| InChIKey | XROSLYFKTXRMAD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|