C14H16N6O — CID 75184721
2-amino-N-(6-amino-5-phenyldiazenyl-2-pyridinyl)propanamide (PubChem CID 75184721) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-amino-N-(6-amino-5-phenyldiazenyl-2-pyridinyl)propanamide.
| Compound Name | 2-amino-N-(6-amino-5-phenyldiazenyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 75184721 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-amino-N-(6-amino-5-phenyldiazenyl-2-pyridinyl)propanamide |
| SMILES | CC(N)C(=O)Nc1ccc(/N=N/c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C14H16N6O/c1-9(15)14(21)18-12-8-7-11(13(16)17-12)20-19-10-5-3-2-4-6-10/h2-9H,15H2,1H3,(H3,16,17,18,21)/b20-19+ |
| InChIKey | IVLGUJFHBVJGSO-FMQUCBEESA-N |
| XLogP | 2.36 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|