About 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol
4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 751859) has the molecular formula C15H13N3O2S
and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| PubChem CID | 751859 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | Cc1cccc(Nc2nc(-c3ccc(O)c(O)c3)cs2)n1 |
| InChI | InChI=1S/C15H13N3O2S/c1-9-3-2-4-14(16-9)18-15-17-11(8-21-15)10-5-6-12(19)13(20)7-10/h2-8,19-20H,1H3,(H,16,17,18) |
| InChIKey | ZXYULNRJXNYFIE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The IUPAC name of 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol (CID 751859) is 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol.
What is the SMILES notation for 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The canonical SMILES for 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol is Cc1cccc(Nc2nc(-c3ccc(O)c(O)c3)cs2)n1.
What is the InChIKey of 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol?
The InChIKey is ZXYULNRJXNYFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2S/c1-9-3-2-4-14(16-9)18-15-17-11(8-21-15)10-5-6-12(19)13(20)7-10/h2-8,19-20H,1H3,(H,16,17,18).
What are the key properties of 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol?
4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol has a molecular weight of 299.36 g/mol, XLogP of 3.67, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(6-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]benzene-1,2-diol is sourced from PubChem (CID 751859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).