C25H27N5OS — CID 75187239
N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-5-thiophen-2-ylpyrazolidine-3-carboxamide (PubChem CID 75187239) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-5-thiophen-2-ylpyrazolidine-3-carboxamide.
| Compound Name | N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-5-thiophen-2-ylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75187239 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | N-[4-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]-5-thiophen-2-ylpyrazolidine-3-carboxamide |
| SMILES | CCn1c(CCc2ccc(NC(=O)C3CC(c4cccs4)NN3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C25H27N5OS/c1-2-30-22-7-4-3-6-19(22)27-24(30)14-11-17-9-12-18(13-10-17)26-25(31)21-16-20(28-29-21)23-8-5-15-32-23/h3-10,12-13,15,20-21,28-29H,2,11,14,16H2,1H3,(H,26,31) |
| InChIKey | HBGJHRGHFAHAJW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |