C14H14Cl2N2O3S2 — CID 7518895
N-[(3aR,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide (PubChem CID 7518895) has the molecular formula C14H14Cl2N2O3S2 and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide.
| Compound Name | N-[(3aR,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide |
|---|---|
| PubChem CID | 7518895 |
| Molecular Formula | C14H14Cl2N2O3S2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-[(3aR,6aR)-3-(3,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]propanamide |
| SMILES | CCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O3S2/c1-2-13(19)17-14-18(10-4-8(15)3-9(16)5-10)11-6-23(20,21)7-12(11)22-14/h3-5,11-12H,2,6-7H2,1H3/b17-14-/t11-,12+/m1/s1 |
| InChIKey | LHHZZZKKVOOWEN-PDXPXHEVSA-N |
| XLogP | 3.00 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|