About 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol
4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 751906) has the molecular formula C14H11N3O2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
| PubChem CID | 751906 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2csc(Nc3ccccn3)n2)c(O)c1 |
| InChI | InChI=1S/C14H11N3O2S/c18-9-4-5-10(12(19)7-9)11-8-20-14(16-11)17-13-3-1-2-6-15-13/h1-8,18-19H,(H,15,16,17) |
| InChIKey | SUZVYWLDXDAKRD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol?
The IUPAC name of 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol (CID 751906) is 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol.
What is the SMILES notation for 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol?
The canonical SMILES for 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol is Oc1ccc(-c2csc(Nc3ccccn3)n2)c(O)c1.
What is the InChIKey of 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol?
The InChIKey is SUZVYWLDXDAKRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2S/c18-9-4-5-10(12(19)7-9)11-8-20-14(16-11)17-13-3-1-2-6-15-13/h1-8,18-19H,(H,15,16,17).
What are the key properties of 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol?
4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol has a molecular weight of 285.33 g/mol, XLogP of 3.36, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(pyridin-2-ylamino)-1,3-thiazol-4-yl]benzene-1,3-diol is sourced from PubChem (CID 751906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).