About 6,7-dimethoxyquinoxaline-2,3-dione;hydrate
6,7-dimethoxyquinoxaline-2,3-dione;hydrate (PubChem CID 75192750) has the molecular formula C10H10N2O5
and a molecular weight of 238.20 g/mol. Its IUPAC name is 6,7-dimethoxyquinoxaline-2,3-dione;hydrate.
Molecular Properties
| Compound Name | 6,7-dimethoxyquinoxaline-2,3-dione;hydrate |
| PubChem CID | 75192750 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 6,7-dimethoxyquinoxaline-2,3-dione;hydrate |
| SMILES | COc1cc2c(cc1OC)=NC(=O)C(=O)N=2.O |
| InChI | InChI=1S/C10H8N2O4.H2O/c1-15-7-3-5-6(4-8(7)16-2)12-10(14)9(13)11-5;/h3-4H,1-2H3;1H2 |
| InChIKey | LOPKETOJAKEUTA-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 108.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethoxyquinoxaline-2,3-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxyquinoxaline-2,3-dione;hydrate?
The IUPAC name of 6,7-dimethoxyquinoxaline-2,3-dione;hydrate (CID 75192750) is 6,7-dimethoxyquinoxaline-2,3-dione;hydrate.
What is the SMILES notation for 6,7-dimethoxyquinoxaline-2,3-dione;hydrate?
The canonical SMILES for 6,7-dimethoxyquinoxaline-2,3-dione;hydrate is COc1cc2c(cc1OC)=NC(=O)C(=O)N=2.O.
What is the InChIKey of 6,7-dimethoxyquinoxaline-2,3-dione;hydrate?
The InChIKey is LOPKETOJAKEUTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4.H2O/c1-15-7-3-5-6(4-8(7)16-2)12-10(14)9(13)11-5;/h3-4H,1-2H3;1H2.
What are the key properties of 6,7-dimethoxyquinoxaline-2,3-dione;hydrate?
6,7-dimethoxyquinoxaline-2,3-dione;hydrate has a molecular weight of 238.20 g/mol, XLogP of -1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxyquinoxaline-2,3-dione;hydrate is sourced from PubChem (CID 75192750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).