C9H17NO — CID 75193259
1,2,3,4,5,6,7,7a-octahydroisoindol-3a-ylmethanol (PubChem CID 75193259) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,7a-octahydroisoindol-3a-ylmethanol.
| Compound Name | 1,2,3,4,5,6,7,7a-octahydroisoindol-3a-ylmethanol |
|---|---|
| PubChem CID | 75193259 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1,2,3,4,5,6,7,7a-octahydroisoindol-3a-ylmethanol |
| SMILES | OCC12CCCCC1CNC2 |
| InChI | InChI=1S/C9H17NO/c11-7-9-4-2-1-3-8(9)5-10-6-9/h8,10-11H,1-7H2 |
| InChIKey | HKTBIXJIDRLJOD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |