C21H34NO3+ — CID 751982
4-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium (PubChem CID 751982) has the molecular formula C21H34NO3+ and a molecular weight of 348.51 g/mol. Its IUPAC name is 4-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium.
| Compound Name | 4-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 751982 |
| Molecular Formula | C21H34NO3+ |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 4-[[(2R,4S)-2-[2-(4-tert-butylphenyl)ethyl]-1,3-dioxolan-4-yl]methyl]-4-methylmorpholin-4-ium |
| SMILES | CC(C)(C)c1ccc(CC[C@@H]2OC[C@H](C[N+]3(C)CCOCC3)O2)cc1 |
| InChI | InChI=1S/C21H34NO3/c1-21(2,3)18-8-5-17(6-9-18)7-10-20-24-16-19(25-20)15-22(4)11-13-23-14-12-22/h5-6,8-9,19-20H,7,10-16H2,1-4H3/q+1/t19-,20+/m0/s1 |
| InChIKey | XGSOAQKWLVYPTJ-VQTJNVASSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|