C15H14N4O4S2 — CID 7519902
7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 7519902) has the molecular formula C15H14N4O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 7519902 |
| Molecular Formula | C15H14N4O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | COc1ccc(C(=O)CSc2nn3c(=O)c(C)nnc3s2)cc1OC |
| InChI | InChI=1S/C15H14N4O4S2/c1-8-13(21)19-14(17-16-8)25-15(18-19)24-7-10(20)9-4-5-11(22-2)12(6-9)23-3/h4-6H,7H2,1-3H3 |
| InChIKey | FOTHILYUYDWOJN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |