C18H20N4O3S2 — CID 7519970
7-(3,3-dimethyl-2-oxobutyl)sulfanyl-3-[(4-methoxyphenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 7519970) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 7-(3,3-dimethyl-2-oxobutyl)sulfanyl-3-[(4-methoxyphenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 7-(3,3-dimethyl-2-oxobutyl)sulfanyl-3-[(4-methoxyphenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 7519970 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 7-(3,3-dimethyl-2-oxobutyl)sulfanyl-3-[(4-methoxyphenyl)methyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | COc1ccc(Cc2nnc3sc(SCC(=O)C(C)(C)C)nn3c2=O)cc1 |
| InChI | InChI=1S/C18H20N4O3S2/c1-18(2,3)14(23)10-26-17-21-22-15(24)13(19-20-16(22)27-17)9-11-5-7-12(25-4)8-6-11/h5-8H,9-10H2,1-4H3 |
| InChIKey | JUZKOXPLQBRGTK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |