C30H34F2NO3P — CID 75201312
3-[[4-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)buta-1,2-dienyl]-2-ethylphenyl]methylamino]propylphosphonic acid (PubChem CID 75201312) has the molecular formula C30H34F2NO3P and a molecular weight of 525.58 g/mol. Its IUPAC name is 3-[[4-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)buta-1,2-dienyl]-2-ethylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)buta-1,2-dienyl]-2-ethylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 75201312 |
| Molecular Formula | C30H34F2NO3P |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 3-[[4-[3-(3,5-difluorophenyl)-4-(3,4-dimethylphenyl)buta-1,2-dienyl]-2-ethylphenyl]methylamino]propylphosphonic acid |
| SMILES | CCc1cc(C=C=C(Cc2ccc(C)c(C)c2)c2cc(F)cc(F)c2)ccc1CNCCCP(=O)(O)O |
| InChI | InChI=1S/C30H34F2NO3P/c1-4-25-15-23(9-11-27(25)20-33-12-5-13-37(34,35)36)8-10-26(28-17-29(31)19-30(32)18-28)16-24-7-6-21(2)22(3)14-24/h6-9,11,14-15,17-19,33H,4-5,12-13,16,20H2,1-3H3,(H2,34,35,36) |
| InChIKey | SKWJLHZRIGBSMX-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|