About (E)-9-oxohexadec-7-enoic acid
(E)-9-oxohexadec-7-enoic acid (PubChem CID 75201659) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is (E)-9-oxohexadec-7-enoic acid.
Molecular Properties
| Compound Name | (E)-9-oxohexadec-7-enoic acid |
| PubChem CID | 75201659 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (E)-9-oxohexadec-7-enoic acid |
| SMILES | CCCCCCCC(=O)/C=C/CCCCCC(=O)O |
| InChI | InChI=1S/C16H28O3/c1-2-3-4-6-9-12-15(17)13-10-7-5-8-11-14-16(18)19/h10,13H,2-9,11-12,14H2,1H3,(H,18,19)/b13-10+ |
| InChIKey | HPFYZBFCKCJWJR-JLHYYAGUSA-N |
| XLogP | 4.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-9-oxohexadec-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-9-oxohexadec-7-enoic acid?
The IUPAC name of (E)-9-oxohexadec-7-enoic acid (CID 75201659) is (E)-9-oxohexadec-7-enoic acid.
What is the SMILES notation for (E)-9-oxohexadec-7-enoic acid?
The canonical SMILES for (E)-9-oxohexadec-7-enoic acid is CCCCCCCC(=O)/C=C/CCCCCC(=O)O.
What is the InChIKey of (E)-9-oxohexadec-7-enoic acid?
The InChIKey is HPFYZBFCKCJWJR-JLHYYAGUSA-N. The full InChI is InChI=1S/C16H28O3/c1-2-3-4-6-9-12-15(17)13-10-7-5-8-11-14-16(18)19/h10,13H,2-9,11-12,14H2,1H3,(H,18,19)/b13-10+.
What are the key properties of (E)-9-oxohexadec-7-enoic acid?
(E)-9-oxohexadec-7-enoic acid has a molecular weight of 268.40 g/mol, XLogP of 4.51, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-9-oxohexadec-7-enoic acid is sourced from PubChem (CID 75201659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).